C17H23N3O — CID 131652790
7-(pyrrol-1-ylmethyl)-4-(1H-pyrrol-2-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine (PubChem CID 131652790) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is 7-(pyrrol-1-ylmethyl)-4-(1H-pyrrol-2-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine.
| Compound Name | 7-(pyrrol-1-ylmethyl)-4-(1H-pyrrol-2-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
|---|---|
| PubChem CID | 131652790 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 7-(pyrrol-1-ylmethyl)-4-(1H-pyrrol-2-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
| SMILES | c1c[nH]c(CN2CCOC3C(Cn4cccc4)CCC32)c1 |
| InChI | InChI=1S/C17H23N3O/c1-2-9-19(8-1)12-14-5-6-16-17(14)21-11-10-20(16)13-15-4-3-7-18-15/h1-4,7-9,14,16-18H,5-6,10-13H2 |
| InChIKey | UDUCYYMVLBHZHH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 33.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |