C18H26FN3O3 — CID 131654712
2-(5-fluoropyrimidin-2-yl)-8-[2-(oxan-4-ylmethoxy)ethyl]-5-oxa-2-azaspiro[3.4]octane (PubChem CID 131654712) has the molecular formula C18H26FN3O3 and a molecular weight of 351.42 g/mol. Its IUPAC name is 2-(5-fluoropyrimidin-2-yl)-8-[2-(oxan-4-ylmethoxy)ethyl]-5-oxa-2-azaspiro[3.4]octane.
| Compound Name | 2-(5-fluoropyrimidin-2-yl)-8-[2-(oxan-4-ylmethoxy)ethyl]-5-oxa-2-azaspiro[3.4]octane |
|---|---|
| PubChem CID | 131654712 |
| Molecular Formula | C18H26FN3O3 |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | 2-(5-fluoropyrimidin-2-yl)-8-[2-(oxan-4-ylmethoxy)ethyl]-5-oxa-2-azaspiro[3.4]octane |
| SMILES | Fc1cnc(N2CC3(C2)OCCC3CCOCC2CCOCC2)nc1 |
| InChI | InChI=1S/C18H26FN3O3/c19-16-9-20-17(21-10-16)22-12-18(13-22)15(4-8-25-18)3-7-24-11-14-1-5-23-6-2-14/h9-10,14-15H,1-8,11-13H2 |
| InChIKey | YOCYOEQMUBQAFM-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 56.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|