C17H24N6O2 — CID 131654713
1-methyl-N-[[7-(oxolan-3-yl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]methyl]imidazole-2-carboxamide (PubChem CID 131654713) has the molecular formula C17H24N6O2 and a molecular weight of 344.42 g/mol. Its IUPAC name is 1-methyl-N-[[7-(oxolan-3-yl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]methyl]imidazole-2-carboxamide.
| Compound Name | 1-methyl-N-[[7-(oxolan-3-yl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]methyl]imidazole-2-carboxamide |
|---|---|
| PubChem CID | 131654713 |
| Molecular Formula | C17H24N6O2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 1-methyl-N-[[7-(oxolan-3-yl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]methyl]imidazole-2-carboxamide |
| SMILES | Cn1ccnc1C(=O)NCc1cnc2n1CCN(C1CCOC1)CC2 |
| InChI | InChI=1S/C17H24N6O2/c1-21-6-4-18-16(21)17(24)20-11-14-10-19-15-2-5-22(7-8-23(14)15)13-3-9-25-12-13/h4,6,10,13H,2-3,5,7-9,11-12H2,1H3,(H,20,24) |
| InChIKey | UWGJDFFXFHWKLD-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 77.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |