C18H25N5O2 — CID 97467216
1-methyl-N-[[7-[(3R)-oxolan-3-yl]-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]methyl]pyrrole-2-carboxamide (PubChem CID 97467216) has the molecular formula C18H25N5O2 and a molecular weight of 343.43 g/mol. Its IUPAC name is 1-methyl-N-[[7-[(3R)-oxolan-3-yl]-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]methyl]pyrrole-2-carboxamide.
| Compound Name | 1-methyl-N-[[7-[(3R)-oxolan-3-yl]-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]methyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 97467216 |
| Molecular Formula | C18H25N5O2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | 1-methyl-N-[[7-[(3R)-oxolan-3-yl]-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]methyl]pyrrole-2-carboxamide |
| SMILES | Cn1cccc1C(=O)NCc1cnc2n1CCN([C@@H]1CCOC1)CC2 |
| InChI | InChI=1S/C18H25N5O2/c1-21-6-2-3-16(21)18(24)20-12-15-11-19-17-4-7-22(8-9-23(15)17)14-5-10-25-13-14/h2-3,6,11,14H,4-5,7-10,12-13H2,1H3,(H,20,24)/t14-/m1/s1 |
| InChIKey | XPYHYMTYVISUIY-CQSZACIVSA-N |
| XLogP | 0.80 |
| TPSA | 64.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |