C18H20N2O2S — CID 131659491
N-(2-oxo-1-prop-2-enyl-5,6,7,8-tetrahydroquinolin-6-yl)-2-thiophen-2-ylacetamide (PubChem CID 131659491) has the molecular formula C18H20N2O2S and a molecular weight of 328.44 g/mol. Its IUPAC name is N-(2-oxo-1-prop-2-enyl-5,6,7,8-tetrahydroquinolin-6-yl)-2-thiophen-2-ylacetamide.
| Compound Name | N-(2-oxo-1-prop-2-enyl-5,6,7,8-tetrahydroquinolin-6-yl)-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 131659491 |
| Molecular Formula | C18H20N2O2S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | N-(2-oxo-1-prop-2-enyl-5,6,7,8-tetrahydroquinolin-6-yl)-2-thiophen-2-ylacetamide |
| SMILES | C=CCn1c2c(ccc1=O)CC(NC(=O)Cc1cccs1)CC2 |
| InChI | InChI=1S/C18H20N2O2S/c1-2-9-20-16-7-6-14(11-13(16)5-8-18(20)22)19-17(21)12-15-4-3-10-23-15/h2-5,8,10,14H,1,6-7,9,11-12H2,(H,19,21) |
| InChIKey | QUIPNJZILVNOHZ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|