C18H20N2O3S — CID 97389951
N-[(6R)-2-oxo-1-prop-2-enyl-5,6,7,8-tetrahydroquinolin-6-yl]benzenesulfonamide (PubChem CID 97389951) has the molecular formula C18H20N2O3S and a molecular weight of 344.44 g/mol. Its IUPAC name is N-[(6R)-2-oxo-1-prop-2-enyl-5,6,7,8-tetrahydroquinolin-6-yl]benzenesulfonamide.
| Compound Name | N-[(6R)-2-oxo-1-prop-2-enyl-5,6,7,8-tetrahydroquinolin-6-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 97389951 |
| Molecular Formula | C18H20N2O3S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | N-[(6R)-2-oxo-1-prop-2-enyl-5,6,7,8-tetrahydroquinolin-6-yl]benzenesulfonamide |
| SMILES | C=CCn1c2c(ccc1=O)C[C@H](NS(=O)(=O)c1ccccc1)CC2 |
| InChI | InChI=1S/C18H20N2O3S/c1-2-12-20-17-10-9-15(13-14(17)8-11-18(20)21)19-24(22,23)16-6-4-3-5-7-16/h2-8,11,15,19H,1,9-10,12-13H2/t15-/m1/s1 |
| InChIKey | SASDLDQMOCVYDT-OAHLLOKOSA-N |
| XLogP | 1.87 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|