C20H29NO3S — CID 131659692
[4-[2-(cyclopropylmethoxy)ethyl]-1-oxa-8-azaspiro[4.5]decan-8-yl]-(3-methylthiophen-2-yl)methanone (PubChem CID 131659692) has the molecular formula C20H29NO3S and a molecular weight of 363.52 g/mol. Its IUPAC name is [4-[2-(cyclopropylmethoxy)ethyl]-1-oxa-8-azaspiro[4.5]decan-8-yl]-(3-methylthiophen-2-yl)methanone.
| Compound Name | [4-[2-(cyclopropylmethoxy)ethyl]-1-oxa-8-azaspiro[4.5]decan-8-yl]-(3-methylthiophen-2-yl)methanone |
|---|---|
| PubChem CID | 131659692 |
| Molecular Formula | C20H29NO3S |
| Molecular Weight | 363.52 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | [4-[2-(cyclopropylmethoxy)ethyl]-1-oxa-8-azaspiro[4.5]decan-8-yl]-(3-methylthiophen-2-yl)methanone |
| SMILES | Cc1ccsc1C(=O)N1CCC2(CC1)OCCC2CCOCC1CC1 |
| InChI | InChI=1S/C20H29NO3S/c1-15-6-13-25-18(15)19(22)21-9-7-20(8-10-21)17(5-12-24-20)4-11-23-14-16-2-3-16/h6,13,16-17H,2-5,7-12,14H2,1H3 |
| InChIKey | RIJSQXZXUKHLIE-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.52 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|