C21H27F2NO3 — CID 124789427
[(4R)-4-[2-(cyclopropylmethoxy)ethyl]-1-oxa-8-azaspiro[4.5]decan-8-yl]-(3,4-difluorophenyl)methanone (PubChem CID 124789427) has the molecular formula C21H27F2NO3 and a molecular weight of 379.45 g/mol. Its IUPAC name is [(4R)-4-[2-(cyclopropylmethoxy)ethyl]-1-oxa-8-azaspiro[4.5]decan-8-yl]-(3,4-difluorophenyl)methanone.
| Compound Name | [(4R)-4-[2-(cyclopropylmethoxy)ethyl]-1-oxa-8-azaspiro[4.5]decan-8-yl]-(3,4-difluorophenyl)methanone |
|---|---|
| PubChem CID | 124789427 |
| Molecular Formula | C21H27F2NO3 |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | [(4R)-4-[2-(cyclopropylmethoxy)ethyl]-1-oxa-8-azaspiro[4.5]decan-8-yl]-(3,4-difluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)c(F)c1)N1CCC2(CC1)OCC[C@H]2CCOCC1CC1 |
| InChI | InChI=1S/C21H27F2NO3/c22-18-4-3-16(13-19(18)23)20(25)24-9-7-21(8-10-24)17(6-12-27-21)5-11-26-14-15-1-2-15/h3-4,13,15,17H,1-2,5-12,14H2/t17-/m1/s1 |
| InChIKey | IBKVMDVRYVJUAB-QGZVFWFLSA-N |
| XLogP | 3.79 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|