C19H25ClFNO3 — CID 124870354
(3-chloro-4-fluorophenyl)-[(4R)-4-(2-ethoxyethyl)-1-oxa-8-azaspiro[4.5]decan-8-yl]methanone (PubChem CID 124870354) has the molecular formula C19H25ClFNO3 and a molecular weight of 369.86 g/mol. Its IUPAC name is (3-chloro-4-fluorophenyl)-[(4R)-4-(2-ethoxyethyl)-1-oxa-8-azaspiro[4.5]decan-8-yl]methanone.
| Compound Name | (3-chloro-4-fluorophenyl)-[(4R)-4-(2-ethoxyethyl)-1-oxa-8-azaspiro[4.5]decan-8-yl]methanone |
|---|---|
| PubChem CID | 124870354 |
| Molecular Formula | C19H25ClFNO3 |
| Molecular Weight | 369.86 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | (3-chloro-4-fluorophenyl)-[(4R)-4-(2-ethoxyethyl)-1-oxa-8-azaspiro[4.5]decan-8-yl]methanone |
| SMILES | CCOCC[C@@H]1CCOC12CCN(C(=O)c1ccc(F)c(Cl)c1)CC2 |
| InChI | InChI=1S/C19H25ClFNO3/c1-2-24-11-5-15-6-12-25-19(15)7-9-22(10-8-19)18(23)14-3-4-17(21)16(20)13-14/h3-4,13,15H,2,5-12H2,1H3/t15-/m1/s1 |
| InChIKey | ZOPMCRAKMVTXCV-OAHLLOKOSA-N |
| XLogP | 3.92 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.86 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|