C20H28FNO4 — CID 124821118
[(4R)-4-(2-ethoxyethyl)-1-oxa-8-azaspiro[4.5]decan-8-yl]-(3-fluoro-4-methoxyphenyl)methanone (PubChem CID 124821118) has the molecular formula C20H28FNO4 and a molecular weight of 365.45 g/mol. Its IUPAC name is [(4R)-4-(2-ethoxyethyl)-1-oxa-8-azaspiro[4.5]decan-8-yl]-(3-fluoro-4-methoxyphenyl)methanone.
| Compound Name | [(4R)-4-(2-ethoxyethyl)-1-oxa-8-azaspiro[4.5]decan-8-yl]-(3-fluoro-4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 124821118 |
| Molecular Formula | C20H28FNO4 |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | [(4R)-4-(2-ethoxyethyl)-1-oxa-8-azaspiro[4.5]decan-8-yl]-(3-fluoro-4-methoxyphenyl)methanone |
| SMILES | CCOCC[C@@H]1CCOC12CCN(C(=O)c1ccc(OC)c(F)c1)CC2 |
| InChI | InChI=1S/C20H28FNO4/c1-3-25-12-6-16-7-13-26-20(16)8-10-22(11-9-20)19(23)15-4-5-18(24-2)17(21)14-15/h4-5,14,16H,3,6-13H2,1-2H3/t16-/m1/s1 |
| InChIKey | ZJWWEKFTWYGASS-MRXNPFEDSA-N |
| XLogP | 3.27 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|