C19H27NO4 — CID 131663288
[8-(2-ethoxyethyl)-5-oxa-2-azaspiro[3.4]octan-2-yl]-(3-ethoxyphenyl)methanone (PubChem CID 131663288) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is [8-(2-ethoxyethyl)-5-oxa-2-azaspiro[3.4]octan-2-yl]-(3-ethoxyphenyl)methanone.
| Compound Name | [8-(2-ethoxyethyl)-5-oxa-2-azaspiro[3.4]octan-2-yl]-(3-ethoxyphenyl)methanone |
|---|---|
| PubChem CID | 131663288 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | [8-(2-ethoxyethyl)-5-oxa-2-azaspiro[3.4]octan-2-yl]-(3-ethoxyphenyl)methanone |
| SMILES | CCOCCC1CCOC12CN(C(=O)c1cccc(OCC)c1)C2 |
| InChI | InChI=1S/C19H27NO4/c1-3-22-10-8-16-9-11-24-19(16)13-20(14-19)18(21)15-6-5-7-17(12-15)23-4-2/h5-7,12,16H,3-4,8-11,13-14H2,1-2H3 |
| InChIKey | OTVCWIVPBBJPHX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|