C21H30FNO4 — CID 124799575
1-[(4R)-4-(2-ethoxyethyl)-1-oxa-8-azaspiro[4.5]decan-8-yl]-2-(4-fluoro-2-methoxyphenyl)ethanone (PubChem CID 124799575) has the molecular formula C21H30FNO4 and a molecular weight of 379.47 g/mol. Its IUPAC name is 1-[(4R)-4-(2-ethoxyethyl)-1-oxa-8-azaspiro[4.5]decan-8-yl]-2-(4-fluoro-2-methoxyphenyl)ethanone.
| Compound Name | 1-[(4R)-4-(2-ethoxyethyl)-1-oxa-8-azaspiro[4.5]decan-8-yl]-2-(4-fluoro-2-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 124799575 |
| Molecular Formula | C21H30FNO4 |
| Molecular Weight | 379.47 g/mol |
| Exact Mass | 379.22 |
| IUPAC Name | 1-[(4R)-4-(2-ethoxyethyl)-1-oxa-8-azaspiro[4.5]decan-8-yl]-2-(4-fluoro-2-methoxyphenyl)ethanone |
| SMILES | CCOCC[C@@H]1CCOC12CCN(C(=O)Cc1ccc(F)cc1OC)CC2 |
| InChI | InChI=1S/C21H30FNO4/c1-3-26-12-6-17-7-13-27-21(17)8-10-23(11-9-21)20(24)14-16-4-5-18(22)15-19(16)25-2/h4-5,15,17H,3,6-14H2,1-2H3/t17-/m1/s1 |
| InChIKey | ZFJTTYZUOTWFGR-QGZVFWFLSA-N |
| XLogP | 3.20 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|