C18H24FNO3 — CID 124998798
2-(4-fluoro-2-methylphenyl)-1-[(5R)-5-hydroxy-1-oxa-9-azaspiro[5.5]undecan-9-yl]ethanone (PubChem CID 124998798) has the molecular formula C18H24FNO3 and a molecular weight of 321.39 g/mol. Its IUPAC name is 2-(4-fluoro-2-methylphenyl)-1-[(5R)-5-hydroxy-1-oxa-9-azaspiro[5.5]undecan-9-yl]ethanone.
| Compound Name | 2-(4-fluoro-2-methylphenyl)-1-[(5R)-5-hydroxy-1-oxa-9-azaspiro[5.5]undecan-9-yl]ethanone |
|---|---|
| PubChem CID | 124998798 |
| Molecular Formula | C18H24FNO3 |
| Molecular Weight | 321.39 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 2-(4-fluoro-2-methylphenyl)-1-[(5R)-5-hydroxy-1-oxa-9-azaspiro[5.5]undecan-9-yl]ethanone |
| SMILES | Cc1cc(F)ccc1CC(=O)N1CCC2(CC1)OCCC[C@H]2O |
| InChI | InChI=1S/C18H24FNO3/c1-13-11-15(19)5-4-14(13)12-17(22)20-8-6-18(7-9-20)16(21)3-2-10-23-18/h4-5,11,16,21H,2-3,6-10,12H2,1H3/t16-/m1/s1 |
| InChIKey | RKIBJLYOLGLSKP-MRXNPFEDSA-N |
| XLogP | 2.21 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.39 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |