C16H19ClFNO3 — CID 97196154
(2-chloro-4-fluorophenyl)-[(5S)-5-hydroxy-1-oxa-9-azaspiro[5.5]undecan-9-yl]methanone (PubChem CID 97196154) has the molecular formula C16H19ClFNO3 and a molecular weight of 327.78 g/mol. Its IUPAC name is (2-chloro-4-fluorophenyl)-[(5S)-5-hydroxy-1-oxa-9-azaspiro[5.5]undecan-9-yl]methanone.
| Compound Name | (2-chloro-4-fluorophenyl)-[(5S)-5-hydroxy-1-oxa-9-azaspiro[5.5]undecan-9-yl]methanone |
|---|---|
| PubChem CID | 97196154 |
| Molecular Formula | C16H19ClFNO3 |
| Molecular Weight | 327.78 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | (2-chloro-4-fluorophenyl)-[(5S)-5-hydroxy-1-oxa-9-azaspiro[5.5]undecan-9-yl]methanone |
| SMILES | O=C(c1ccc(F)cc1Cl)N1CCC2(CC1)OCCC[C@@H]2O |
| InChI | InChI=1S/C16H19ClFNO3/c17-13-10-11(18)3-4-12(13)15(21)19-7-5-16(6-8-19)14(20)2-1-9-22-16/h3-4,10,14,20H,1-2,5-9H2/t14-/m0/s1 |
| InChIKey | YQWYFKWNGQNRGR-AWEZNQCLSA-N |
| XLogP | 2.63 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.78 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |