C17H22FNO4 — CID 72939846
2-(3-fluorophenoxy)-1-(5-hydroxy-1-oxa-9-azaspiro[5.5]undecan-9-yl)ethanone (PubChem CID 72939846) has the molecular formula C17H22FNO4 and a molecular weight of 323.36 g/mol. Its IUPAC name is 2-(3-fluorophenoxy)-1-(5-hydroxy-1-oxa-9-azaspiro[5.5]undecan-9-yl)ethanone.
| Compound Name | 2-(3-fluorophenoxy)-1-(5-hydroxy-1-oxa-9-azaspiro[5.5]undecan-9-yl)ethanone |
|---|---|
| PubChem CID | 72939846 |
| Molecular Formula | C17H22FNO4 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 2-(3-fluorophenoxy)-1-(5-hydroxy-1-oxa-9-azaspiro[5.5]undecan-9-yl)ethanone |
| SMILES | O=C(COc1cccc(F)c1)N1CCC2(CC1)OCCCC2O |
| InChI | InChI=1S/C17H22FNO4/c18-13-3-1-4-14(11-13)22-12-16(21)19-8-6-17(7-9-19)15(20)5-2-10-23-17/h1,3-4,11,15,20H,2,5-10,12H2 |
| InChIKey | XXVCAZOCVKPHMB-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |