C16H20FNO3 — CID 154837948
2-(3-fluorophenoxy)-1-(9-hydroxy-3-azabicyclo[3.3.1]nonan-3-yl)ethanone (PubChem CID 154837948) has the molecular formula C16H20FNO3 and a molecular weight of 293.34 g/mol. Its IUPAC name is 2-(3-fluorophenoxy)-1-(9-hydroxy-3-azabicyclo[3.3.1]nonan-3-yl)ethanone.
| Compound Name | 2-(3-fluorophenoxy)-1-(9-hydroxy-3-azabicyclo[3.3.1]nonan-3-yl)ethanone |
|---|---|
| PubChem CID | 154837948 |
| Molecular Formula | C16H20FNO3 |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 2-(3-fluorophenoxy)-1-(9-hydroxy-3-azabicyclo[3.3.1]nonan-3-yl)ethanone |
| SMILES | O=C(COc1cccc(F)c1)N1CC2CCCC(C1)C2O |
| InChI | InChI=1S/C16H20FNO3/c17-13-5-2-6-14(7-13)21-10-15(19)18-8-11-3-1-4-12(9-18)16(11)20/h2,5-7,11-12,16,20H,1,3-4,8-10H2 |
| InChIKey | KVJXXINVMKIDJO-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |