C17H22FNO3 — CID 156605496
1-(3-cyclobutyl-3-hydroxy-4-methylpyrrolidin-1-yl)-2-(3-fluorophenoxy)ethanone (PubChem CID 156605496) has the molecular formula C17H22FNO3 and a molecular weight of 307.36 g/mol. Its IUPAC name is 1-(3-cyclobutyl-3-hydroxy-4-methylpyrrolidin-1-yl)-2-(3-fluorophenoxy)ethanone.
| Compound Name | 1-(3-cyclobutyl-3-hydroxy-4-methylpyrrolidin-1-yl)-2-(3-fluorophenoxy)ethanone |
|---|---|
| PubChem CID | 156605496 |
| Molecular Formula | C17H22FNO3 |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 1-(3-cyclobutyl-3-hydroxy-4-methylpyrrolidin-1-yl)-2-(3-fluorophenoxy)ethanone |
| SMILES | CC1CN(C(=O)COc2cccc(F)c2)CC1(O)C1CCC1 |
| InChI | InChI=1S/C17H22FNO3/c1-12-9-19(11-17(12,21)13-4-2-5-13)16(20)10-22-15-7-3-6-14(18)8-15/h3,6-8,12-13,21H,2,4-5,9-11H2,1H3 |
| InChIKey | XDGXBWHFXIOTQT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |