C18H25NO4 — CID 125024153
1-[(5R)-5-hydroxy-1-oxa-9-azaspiro[5.5]undecan-9-yl]-2-(4-methoxyphenyl)ethanone (PubChem CID 125024153) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is 1-[(5R)-5-hydroxy-1-oxa-9-azaspiro[5.5]undecan-9-yl]-2-(4-methoxyphenyl)ethanone.
| Compound Name | 1-[(5R)-5-hydroxy-1-oxa-9-azaspiro[5.5]undecan-9-yl]-2-(4-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 125024153 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 1-[(5R)-5-hydroxy-1-oxa-9-azaspiro[5.5]undecan-9-yl]-2-(4-methoxyphenyl)ethanone |
| SMILES | COc1ccc(CC(=O)N2CCC3(CC2)OCCC[C@H]3O)cc1 |
| InChI | InChI=1S/C18H25NO4/c1-22-15-6-4-14(5-7-15)13-17(21)19-10-8-18(9-11-19)16(20)3-2-12-23-18/h4-7,16,20H,2-3,8-13H2,1H3/t16-/m1/s1 |
| InChIKey | ZDJZKQSTQYZRMB-MRXNPFEDSA-N |
| XLogP | 1.77 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |