C17H23NO4S — CID 97188468
2-(5-acetylthiophen-3-yl)-1-[(5S)-5-hydroxy-1-oxa-9-azaspiro[5.5]undecan-9-yl]ethanone (PubChem CID 97188468) has the molecular formula C17H23NO4S and a molecular weight of 337.44 g/mol. Its IUPAC name is 2-(5-acetylthiophen-3-yl)-1-[(5S)-5-hydroxy-1-oxa-9-azaspiro[5.5]undecan-9-yl]ethanone.
| Compound Name | 2-(5-acetylthiophen-3-yl)-1-[(5S)-5-hydroxy-1-oxa-9-azaspiro[5.5]undecan-9-yl]ethanone |
|---|---|
| PubChem CID | 97188468 |
| Molecular Formula | C17H23NO4S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 2-(5-acetylthiophen-3-yl)-1-[(5S)-5-hydroxy-1-oxa-9-azaspiro[5.5]undecan-9-yl]ethanone |
| SMILES | CC(=O)c1cc(CC(=O)N2CCC3(CC2)OCCC[C@@H]3O)cs1 |
| InChI | InChI=1S/C17H23NO4S/c1-12(19)14-9-13(11-23-14)10-16(21)18-6-4-17(5-7-18)15(20)3-2-8-22-17/h9,11,15,20H,2-8,10H2,1H3/t15-/m0/s1 |
| InChIKey | DFWHQVGPYQECET-HNNXBMFYSA-N |
| XLogP | 2.03 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |