C22H30N2O6S — CID 172912421
8-[2-(5-acetylthiophen-3-yl)acetyl]-3-(pyrrolidin-1-ylmethyl)-2-oxa-8-azaspiro[4.5]decan-1-one;formic acid (PubChem CID 172912421) has the molecular formula C22H30N2O6S and a molecular weight of 450.56 g/mol. Its IUPAC name is 8-[2-(5-acetylthiophen-3-yl)acetyl]-3-(pyrrolidin-1-ylmethyl)-2-oxa-8-azaspiro[4.5]decan-1-one;formic acid.
| Compound Name | 8-[2-(5-acetylthiophen-3-yl)acetyl]-3-(pyrrolidin-1-ylmethyl)-2-oxa-8-azaspiro[4.5]decan-1-one;formic acid |
|---|---|
| PubChem CID | 172912421 |
| Molecular Formula | C22H30N2O6S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 8-[2-(5-acetylthiophen-3-yl)acetyl]-3-(pyrrolidin-1-ylmethyl)-2-oxa-8-azaspiro[4.5]decan-1-one;formic acid |
| SMILES | CC(=O)c1cc(CC(=O)N2CCC3(CC2)CC(CN2CCCC2)OC3=O)cs1.O=CO |
| InChI | InChI=1S/C21H28N2O4S.CH2O2/c1-15(24)18-10-16(14-28-18)11-19(25)23-8-4-21(5-9-23)12-17(27-20(21)26)13-22-6-2-3-7-22;2-1-3/h10,14,17H,2-9,11-13H2,1H3;1H,(H,2,3) |
| InChIKey | UZCHHYGNWOLEAK-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|