C22H31N3O6 — CID 172896975
formic acid;8-[3-(2-oxo-1-pyridinyl)propanoyl]-3-(pyrrolidin-1-ylmethyl)-2-oxa-8-azaspiro[4.5]decan-1-one (PubChem CID 172896975) has the molecular formula C22H31N3O6 and a molecular weight of 433.51 g/mol. Its IUPAC name is formic acid;8-[3-(2-oxo-1-pyridinyl)propanoyl]-3-(pyrrolidin-1-ylmethyl)-2-oxa-8-azaspiro[4.5]decan-1-one.
| Compound Name | formic acid;8-[3-(2-oxo-1-pyridinyl)propanoyl]-3-(pyrrolidin-1-ylmethyl)-2-oxa-8-azaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 172896975 |
| Molecular Formula | C22H31N3O6 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | formic acid;8-[3-(2-oxo-1-pyridinyl)propanoyl]-3-(pyrrolidin-1-ylmethyl)-2-oxa-8-azaspiro[4.5]decan-1-one |
| SMILES | O=C(CCn1ccccc1=O)N1CCC2(CC1)CC(CN1CCCC1)OC2=O.O=CO |
| InChI | InChI=1S/C21H29N3O4.CH2O2/c25-18-5-1-2-11-23(18)12-6-19(26)24-13-7-21(8-14-24)15-17(28-20(21)27)16-22-9-3-4-10-22;2-1-3/h1-2,5,11,17H,3-4,6-10,12-16H2;1H,(H,2,3) |
| InChIKey | WOPFPMHWIMWFPN-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 109.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|