C11H20N2O3S — CID 131662776
1-(1-methylsulfonyl-1,9-diazaspiro[4.5]decan-9-yl)ethanone (PubChem CID 131662776) has the molecular formula C11H20N2O3S and a molecular weight of 260.36 g/mol. Its IUPAC name is 1-(1-methylsulfonyl-1,9-diazaspiro[4.5]decan-9-yl)ethanone.
| Compound Name | 1-(1-methylsulfonyl-1,9-diazaspiro[4.5]decan-9-yl)ethanone |
|---|---|
| PubChem CID | 131662776 |
| Molecular Formula | C11H20N2O3S |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 1-(1-methylsulfonyl-1,9-diazaspiro[4.5]decan-9-yl)ethanone |
| SMILES | CC(=O)N1CCCC2(CCCN2S(C)(=O)=O)C1 |
| InChI | InChI=1S/C11H20N2O3S/c1-10(14)12-7-3-5-11(9-12)6-4-8-13(11)17(2,15)16/h3-9H2,1-2H3 |
| InChIKey | DTZNCPPJMLAXIP-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |