C11H21N3O3S — CID 139379643
(2S)-2-(5-methylsulfonyl-2,5-diazaspiro[3.4]octan-2-yl)butanamide (PubChem CID 139379643) has the molecular formula C11H21N3O3S and a molecular weight of 275.37 g/mol. Its IUPAC name is (2S)-2-(5-methylsulfonyl-2,5-diazaspiro[3.4]octan-2-yl)butanamide.
| Compound Name | (2S)-2-(5-methylsulfonyl-2,5-diazaspiro[3.4]octan-2-yl)butanamide |
|---|---|
| PubChem CID | 139379643 |
| Molecular Formula | C11H21N3O3S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | (2S)-2-(5-methylsulfonyl-2,5-diazaspiro[3.4]octan-2-yl)butanamide |
| SMILES | CC[C@@H](C(N)=O)N1CC2(CCCN2S(C)(=O)=O)C1 |
| InChI | InChI=1S/C11H21N3O3S/c1-3-9(10(12)15)13-7-11(8-13)5-4-6-14(11)18(2,16)17/h9H,3-8H2,1-2H3,(H2,12,15)/t9-/m0/s1 |
| InChIKey | BOODPCRGRGFEPJ-VIFPVBQESA-N |
| XLogP | -0.64 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |