C18H26N6O3 — CID 131672681
2-(2-methylpropyl)-1'-[(1-methylpyrazol-4-yl)methyl]spiro[6,9-dihydro-[1,4]oxazino[3,4-c][1,2,4]triazine-7,3'-pyrrolidine]-3,4-dione (PubChem CID 131672681) has the molecular formula C18H26N6O3 and a molecular weight of 374.45 g/mol. Its IUPAC name is 2-(2-methylpropyl)-1'-[(1-methylpyrazol-4-yl)methyl]spiro[6,9-dihydro-[1,4]oxazino[3,4-c][1,2,4]triazine-7,3'-pyrrolidine]-3,4-dione.
| Compound Name | 2-(2-methylpropyl)-1'-[(1-methylpyrazol-4-yl)methyl]spiro[6,9-dihydro-[1,4]oxazino[3,4-c][1,2,4]triazine-7,3'-pyrrolidine]-3,4-dione |
|---|---|
| PubChem CID | 131672681 |
| Molecular Formula | C18H26N6O3 |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | 2-(2-methylpropyl)-1'-[(1-methylpyrazol-4-yl)methyl]spiro[6,9-dihydro-[1,4]oxazino[3,4-c][1,2,4]triazine-7,3'-pyrrolidine]-3,4-dione |
| SMILES | CC(C)Cn1nc2n(c(=O)c1=O)CC1(CCN(Cc3cnn(C)c3)C1)OC2 |
| InChI | InChI=1S/C18H26N6O3/c1-13(2)7-24-17(26)16(25)23-12-18(27-10-15(23)20-24)4-5-22(11-18)9-14-6-19-21(3)8-14/h6,8,13H,4-5,7,9-12H2,1-3H3 |
| InChIKey | SSCHOYOPCJPIRW-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 87.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|