C18H21FN6O2 — CID 131673069
12-N-(3-fluorophenyl)-5-N,5-N-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.03,7]dodeca-9,11-diene-5,12-dicarboxamide (PubChem CID 131673069) has the molecular formula C18H21FN6O2 and a molecular weight of 372.40 g/mol. Its IUPAC name is 12-N-(3-fluorophenyl)-5-N,5-N-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.03,7]dodeca-9,11-diene-5,12-dicarboxamide.
| Compound Name | 12-N-(3-fluorophenyl)-5-N,5-N-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.03,7]dodeca-9,11-diene-5,12-dicarboxamide |
|---|---|
| PubChem CID | 131673069 |
| Molecular Formula | C18H21FN6O2 |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 12-N-(3-fluorophenyl)-5-N,5-N-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.03,7]dodeca-9,11-diene-5,12-dicarboxamide |
| SMILES | CN(C)C(=O)N1CC2Cc3nnc(C(=O)Nc4cccc(F)c4)n3CC2C1 |
| InChI | InChI=1S/C18H21FN6O2/c1-23(2)18(27)24-8-11-6-15-21-22-16(25(15)10-12(11)9-24)17(26)20-14-5-3-4-13(19)7-14/h3-5,7,11-12H,6,8-10H2,1-2H3,(H,20,26) |
| InChIKey | JMJONJKVMCCVBE-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |