C21H20FN5O3 — CID 131673055
N-(3-fluorophenyl)-5-(2-methylfuran-3-carbonyl)-1,5,10,11-tetrazatricyclo[7.3.0.03,7]dodeca-9,11-diene-12-carboxamide (PubChem CID 131673055) has the molecular formula C21H20FN5O3 and a molecular weight of 409.42 g/mol. Its IUPAC name is N-(3-fluorophenyl)-5-(2-methylfuran-3-carbonyl)-1,5,10,11-tetrazatricyclo[7.3.0.03,7]dodeca-9,11-diene-12-carboxamide.
| Compound Name | N-(3-fluorophenyl)-5-(2-methylfuran-3-carbonyl)-1,5,10,11-tetrazatricyclo[7.3.0.03,7]dodeca-9,11-diene-12-carboxamide |
|---|---|
| PubChem CID | 131673055 |
| Molecular Formula | C21H20FN5O3 |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | N-(3-fluorophenyl)-5-(2-methylfuran-3-carbonyl)-1,5,10,11-tetrazatricyclo[7.3.0.03,7]dodeca-9,11-diene-12-carboxamide |
| SMILES | Cc1occc1C(=O)N1CC2Cc3nnc(C(=O)Nc4cccc(F)c4)n3CC2C1 |
| InChI | InChI=1S/C21H20FN5O3/c1-12-17(5-6-30-12)21(29)26-9-13-7-18-24-25-19(27(18)11-14(13)10-26)20(28)23-16-4-2-3-15(22)8-16/h2-6,8,13-14H,7,9-11H2,1H3,(H,23,28) |
| InChIKey | NPJQDUKLKNXDHJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 93.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |