C21H25N7O2S — CID 131674967
5-[[4-[(2,3-dimethyl-3,3a-dihydroindazol-6-yl)-methylamino]pyrimidin-2-yl]amino]-2-methylbenzenesulfonamide (PubChem CID 131674967) has the molecular formula C21H25N7O2S and a molecular weight of 439.55 g/mol. Its IUPAC name is 5-[[4-[(2,3-dimethyl-3,3a-dihydroindazol-6-yl)-methylamino]pyrimidin-2-yl]amino]-2-methylbenzenesulfonamide.
| Compound Name | 5-[[4-[(2,3-dimethyl-3,3a-dihydroindazol-6-yl)-methylamino]pyrimidin-2-yl]amino]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 131674967 |
| Molecular Formula | C21H25N7O2S |
| Molecular Weight | 439.55 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 5-[[4-[(2,3-dimethyl-3,3a-dihydroindazol-6-yl)-methylamino]pyrimidin-2-yl]amino]-2-methylbenzenesulfonamide |
| SMILES | Cc1ccc(Nc2nccc(N(C)C3=CC4=NN(C)C(C)C4C=C3)n2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C21H25N7O2S/c1-13-5-6-15(11-19(13)31(22,29)30)24-21-23-10-9-20(25-21)27(3)16-7-8-17-14(2)28(4)26-18(17)12-16/h5-12,14,17H,1-4H3,(H2,22,29,30)(H,23,24,25) |
| InChIKey | LEYWIOZTMQWFNP-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.55 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|