C31H38F2N8O3S — CID 142803432
(4E,6E)-4,7-difluoro-3-methyl-N-[[N-methyl-2-(methylamino)-4-[methyl-[2-(4-methyl-3-sulfamoylanilino)pyrimidin-4-yl]amino]anilino]methyl]nona-4,6,8-trienamide (PubChem CID 142803432) has the molecular formula C31H38F2N8O3S and a molecular weight of 640.76 g/mol. Its IUPAC name is (4E,6E)-4,7-difluoro-3-methyl-N-[[N-methyl-2-(methylamino)-4-[methyl-[2-(4-methyl-3-sulfamoylanilino)pyrimidin-4-yl]amino]anilino]methyl]nona-4,6,8-trienamide.
| Compound Name | (4E,6E)-4,7-difluoro-3-methyl-N-[[N-methyl-2-(methylamino)-4-[methyl-[2-(4-methyl-3-sulfamoylanilino)pyrimidin-4-yl]amino]anilino]methyl]nona-4,6,8-trienamide |
|---|---|
| PubChem CID | 142803432 |
| Molecular Formula | C31H38F2N8O3S |
| Molecular Weight | 640.76 g/mol |
| Exact Mass | 640.28 |
| IUPAC Name | (4E,6E)-4,7-difluoro-3-methyl-N-[[N-methyl-2-(methylamino)-4-[methyl-[2-(4-methyl-3-sulfamoylanilino)pyrimidin-4-yl]amino]anilino]methyl]nona-4,6,8-trienamide |
| SMILES | C=C/C(F)=C\C=C(\F)C(C)CC(=O)NCN(C)c1ccc(N(C)c2ccnc(Nc3ccc(C)c(S(N)(=O)=O)c3)n2)cc1NC |
| InChI | InChI=1S/C31H38F2N8O3S/c1-7-22(32)9-12-25(33)21(3)16-30(42)37-19-40(5)27-13-11-24(18-26(27)35-4)41(6)29-14-15-36-31(39-29)38-23-10-8-20(2)28(17-23)45(34,43)44/h7-15,17-18,21,35H,1,16,19H2,2-6H3,(H,37,42)(H2,34,43,44)(H,36,38,39)/b22-9+,25-12+ |
| InChIKey | RYXGHDIVTKBWPN-UKLYWMOHSA-N |
| XLogP | 5.41 |
| TPSA | 145.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.76 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|