C7H10N2S — CID 13167816
2,4-dimethyl-6-methylsulfanylpyrimidine (PubChem CID 13167816) has the molecular formula C7H10N2S and a molecular weight of 154.24 g/mol. Its IUPAC name is 2,4-dimethyl-6-methylsulfanylpyrimidine.
| Compound Name | 2,4-dimethyl-6-methylsulfanylpyrimidine |
|---|---|
| PubChem CID | 13167816 |
| Molecular Formula | C7H10N2S |
| Molecular Weight | 154.24 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 2,4-dimethyl-6-methylsulfanylpyrimidine |
| SMILES | CSc1cc(C)nc(C)n1 |
| InChI | InChI=1S/C7H10N2S/c1-5-4-7(10-3)9-6(2)8-5/h4H,1-3H3 |
| InChIKey | GGTUMQODIYMFCC-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.24 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |