C21H32N2O — CID 131679151
N-[(3aR,4S,8bR)-2-(2-methylbutyl)-3,3a,4,8b-tetrahydro-1H-indeno[1,2-c]pyrrol-4-yl]-2,2-dimethylpropanamide (PubChem CID 131679151) has the molecular formula C21H32N2O and a molecular weight of 328.50 g/mol. Its IUPAC name is N-[(3aR,4S,8bR)-2-(2-methylbutyl)-3,3a,4,8b-tetrahydro-1H-indeno[1,2-c]pyrrol-4-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[(3aR,4S,8bR)-2-(2-methylbutyl)-3,3a,4,8b-tetrahydro-1H-indeno[1,2-c]pyrrol-4-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 131679151 |
| Molecular Formula | C21H32N2O |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.25 |
| IUPAC Name | N-[(3aR,4S,8bR)-2-(2-methylbutyl)-3,3a,4,8b-tetrahydro-1H-indeno[1,2-c]pyrrol-4-yl]-2,2-dimethylpropanamide |
| SMILES | CCC(C)CN1C[C@@H]2[C@H](NC(=O)C(C)(C)C)c3ccccc3[C@@H]2C1 |
| InChI | InChI=1S/C21H32N2O/c1-6-14(2)11-23-12-17-15-9-7-8-10-16(15)19(18(17)13-23)22-20(24)21(3,4)5/h7-10,14,17-19H,6,11-13H2,1-5H3,(H,22,24)/t14?,17-,18-,19+/m0/s1 |
| InChIKey | IXQXMAGWGMTXHM-BIAVLDQUSA-N |
| XLogP | 3.97 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |