C23H30N4O — CID 131679371
cyclobutyl-[8-(3-methylbutyl)spiro[2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaene-7,3'-pyrrolidine]-1'-yl]methanone (PubChem CID 131679371) has the molecular formula C23H30N4O and a molecular weight of 378.52 g/mol. Its IUPAC name is cyclobutyl-[8-(3-methylbutyl)spiro[2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaene-7,3'-pyrrolidine]-1'-yl]methanone.
| Compound Name | cyclobutyl-[8-(3-methylbutyl)spiro[2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaene-7,3'-pyrrolidine]-1'-yl]methanone |
|---|---|
| PubChem CID | 131679371 |
| Molecular Formula | C23H30N4O |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | cyclobutyl-[8-(3-methylbutyl)spiro[2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaene-7,3'-pyrrolidine]-1'-yl]methanone |
| SMILES | CC(C)CCN1c2cccnc2-n2cccc2C12CCN(C(=O)C1CCC1)C2 |
| InChI | InChI=1S/C23H30N4O/c1-17(2)10-14-27-19-8-4-12-24-21(19)26-13-5-9-20(26)23(27)11-15-25(16-23)22(28)18-6-3-7-18/h4-5,8-9,12-13,17-18H,3,6-7,10-11,14-16H2,1-2H3 |
| InChIKey | CSQPPLVJKYKQKT-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |