C23H26N6O — CID 131679384
[8-(3-methylbutyl)spiro[2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaene-7,3'-pyrrolidine]-1'-yl]-pyrazin-2-ylmethanone (PubChem CID 131679384) has the molecular formula C23H26N6O and a molecular weight of 402.50 g/mol. Its IUPAC name is [8-(3-methylbutyl)spiro[2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaene-7,3'-pyrrolidine]-1'-yl]-pyrazin-2-ylmethanone.
| Compound Name | [8-(3-methylbutyl)spiro[2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaene-7,3'-pyrrolidine]-1'-yl]-pyrazin-2-ylmethanone |
|---|---|
| PubChem CID | 131679384 |
| Molecular Formula | C23H26N6O |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | [8-(3-methylbutyl)spiro[2,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaene-7,3'-pyrrolidine]-1'-yl]-pyrazin-2-ylmethanone |
| SMILES | CC(C)CCN1c2cccnc2-n2cccc2C12CCN(C(=O)c1cnccn1)C2 |
| InChI | InChI=1S/C23H26N6O/c1-17(2)7-13-29-19-5-3-9-26-21(19)28-12-4-6-20(28)23(29)8-14-27(16-23)22(30)18-15-24-10-11-25-18/h3-6,9-12,15,17H,7-8,13-14,16H2,1-2H3 |
| InChIKey | PDUDZVVVVGJUDT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |