C17H23FN4O3 — CID 131679935
(1-fluorocyclobutyl)-[3-(4-morpholin-4-ylpyrimidin-2-yl)morpholin-4-yl]methanone (PubChem CID 131679935) has the molecular formula C17H23FN4O3 and a molecular weight of 350.39 g/mol. Its IUPAC name is (1-fluorocyclobutyl)-[3-(4-morpholin-4-ylpyrimidin-2-yl)morpholin-4-yl]methanone.
| Compound Name | (1-fluorocyclobutyl)-[3-(4-morpholin-4-ylpyrimidin-2-yl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 131679935 |
| Molecular Formula | C17H23FN4O3 |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | (1-fluorocyclobutyl)-[3-(4-morpholin-4-ylpyrimidin-2-yl)morpholin-4-yl]methanone |
| SMILES | O=C(N1CCOCC1c1nccc(N2CCOCC2)n1)C1(F)CCC1 |
| InChI | InChI=1S/C17H23FN4O3/c18-17(3-1-4-17)16(23)22-8-11-25-12-13(22)15-19-5-2-14(20-15)21-6-9-24-10-7-21/h2,5,13H,1,3-4,6-12H2 |
| InChIKey | CYROWZRYHFBNBF-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |