C19H29N5O2 — CID 56862502
morpholin-4-yl-[1-(1-pyrimidin-2-ylpiperidin-4-yl)piperidin-3-yl]methanone (PubChem CID 56862502) has the molecular formula C19H29N5O2 and a molecular weight of 359.47 g/mol. Its IUPAC name is morpholin-4-yl-[1-(1-pyrimidin-2-ylpiperidin-4-yl)piperidin-3-yl]methanone.
| Compound Name | morpholin-4-yl-[1-(1-pyrimidin-2-ylpiperidin-4-yl)piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 56862502 |
| Molecular Formula | C19H29N5O2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | morpholin-4-yl-[1-(1-pyrimidin-2-ylpiperidin-4-yl)piperidin-3-yl]methanone |
| SMILES | O=C(C1CCCN(C2CCN(c3ncccn3)CC2)C1)N1CCOCC1 |
| InChI | InChI=1S/C19H29N5O2/c25-18(22-11-13-26-14-12-22)16-3-1-8-24(15-16)17-4-9-23(10-5-17)19-20-6-2-7-21-19/h2,6-7,16-17H,1,3-5,8-15H2 |
| InChIKey | PEIRIBSPXLKARZ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |