C14H20N4O3 — CID 644802
ethyl 2-[(1-pyrimidin-2-ylpiperidine-3-carbonyl)amino]acetate (PubChem CID 644802) has the molecular formula C14H20N4O3 and a molecular weight of 292.34 g/mol. Its IUPAC name is ethyl 2-[(1-pyrimidin-2-ylpiperidine-3-carbonyl)amino]acetate.
| Compound Name | ethyl 2-[(1-pyrimidin-2-ylpiperidine-3-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 644802 |
| Molecular Formula | C14H20N4O3 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | ethyl 2-[(1-pyrimidin-2-ylpiperidine-3-carbonyl)amino]acetate |
| SMILES | CCOC(=O)CNC(=O)C1CCCN(c2ncccn2)C1 |
| InChI | InChI=1S/C14H20N4O3/c1-2-21-12(19)9-17-13(20)11-5-3-8-18(10-11)14-15-6-4-7-16-14/h4,6-7,11H,2-3,5,8-10H2,1H3,(H,17,20) |
| InChIKey | VCZUYYYPEXNVBE-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |