C15H20N6O2 — CID 131680535
(1-methyl-1,2,4-triazol-3-yl)-[7-(pyrazol-1-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]methanone (PubChem CID 131680535) has the molecular formula C15H20N6O2 and a molecular weight of 316.37 g/mol. Its IUPAC name is (1-methyl-1,2,4-triazol-3-yl)-[7-(pyrazol-1-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]methanone.
| Compound Name | (1-methyl-1,2,4-triazol-3-yl)-[7-(pyrazol-1-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]methanone |
|---|---|
| PubChem CID | 131680535 |
| Molecular Formula | C15H20N6O2 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | (1-methyl-1,2,4-triazol-3-yl)-[7-(pyrazol-1-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]methanone |
| SMILES | Cn1cnc(C(=O)N2CCOC3C(Cn4cccn4)CCC32)n1 |
| InChI | InChI=1S/C15H20N6O2/c1-19-10-16-14(18-19)15(22)21-7-8-23-13-11(3-4-12(13)21)9-20-6-2-5-17-20/h2,5-6,10-13H,3-4,7-9H2,1H3 |
| InChIKey | SQVIENRFYGHUJQ-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 78.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |