C17H24N6O3 — CID 131688686
[(3S,3aS,7aR)-3-(3-pyrazol-1-ylpropoxy)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-(1-methyl-1,2,4-triazol-3-yl)methanone (PubChem CID 131688686) has the molecular formula C17H24N6O3 and a molecular weight of 360.42 g/mol. Its IUPAC name is [(3S,3aS,7aR)-3-(3-pyrazol-1-ylpropoxy)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-(1-methyl-1,2,4-triazol-3-yl)methanone.
| Compound Name | [(3S,3aS,7aR)-3-(3-pyrazol-1-ylpropoxy)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-(1-methyl-1,2,4-triazol-3-yl)methanone |
|---|---|
| PubChem CID | 131688686 |
| Molecular Formula | C17H24N6O3 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | [(3S,3aS,7aR)-3-(3-pyrazol-1-ylpropoxy)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]-(1-methyl-1,2,4-triazol-3-yl)methanone |
| SMILES | Cn1cnc(C(=O)N2C[C@H](OCCCn3cccn3)[C@H]3OCCC[C@H]32)n1 |
| InChI | InChI=1S/C17H24N6O3/c1-21-12-18-16(20-21)17(24)23-11-14(15-13(23)5-2-9-26-15)25-10-4-8-22-7-3-6-19-22/h3,6-7,12-15H,2,4-5,8-11H2,1H3/t13-,14+,15+/m1/s1 |
| InChIKey | HRAYDMQQSZCXCN-ILXRZTDVSA-N |
| XLogP | 0.49 |
| TPSA | 87.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|