C14H23N5O2 — CID 131680615
[(5aR,9aS)-4-ethyl-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl]-(1-methyl-1,2,4-triazol-3-yl)methanone (PubChem CID 131680615) has the molecular formula C14H23N5O2 and a molecular weight of 293.37 g/mol. Its IUPAC name is [(5aR,9aS)-4-ethyl-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl]-(1-methyl-1,2,4-triazol-3-yl)methanone.
| Compound Name | [(5aR,9aS)-4-ethyl-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl]-(1-methyl-1,2,4-triazol-3-yl)methanone |
|---|---|
| PubChem CID | 131680615 |
| Molecular Formula | C14H23N5O2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | [(5aR,9aS)-4-ethyl-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl]-(1-methyl-1,2,4-triazol-3-yl)methanone |
| SMILES | CCN1CCO[C@@H]2CN(C(=O)c3ncn(C)n3)CC[C@@H]2C1 |
| InChI | InChI=1S/C14H23N5O2/c1-3-18-6-7-21-12-9-19(5-4-11(12)8-18)14(20)13-15-10-17(2)16-13/h10-12H,3-9H2,1-2H3/t11-,12-/m1/s1 |
| InChIKey | ZIUWUELNYLPETH-VXGBXAGGSA-N |
| XLogP | -0.00 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |