C24H25N3O5S — CID 1316810
[(2R)-1-oxo-1-(4-sulfamoylanilino)butan-2-yl] 1,2,3,4-tetrahydroacridine-9-carboxylate (PubChem CID 1316810) has the molecular formula C24H25N3O5S and a molecular weight of 467.55 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(4-sulfamoylanilino)butan-2-yl] 1,2,3,4-tetrahydroacridine-9-carboxylate.
| Compound Name | [(2R)-1-oxo-1-(4-sulfamoylanilino)butan-2-yl] 1,2,3,4-tetrahydroacridine-9-carboxylate |
|---|---|
| PubChem CID | 1316810 |
| Molecular Formula | C24H25N3O5S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | [(2R)-1-oxo-1-(4-sulfamoylanilino)butan-2-yl] 1,2,3,4-tetrahydroacridine-9-carboxylate |
| SMILES | CC[C@@H](OC(=O)c1c2c(nc3ccccc13)CCCC2)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C24H25N3O5S/c1-2-21(23(28)26-15-11-13-16(14-12-15)33(25,30)31)32-24(29)22-17-7-3-5-9-19(17)27-20-10-6-4-8-18(20)22/h3,5,7,9,11-14,21H,2,4,6,8,10H2,1H3,(H,26,28)(H2,25,30,31)/t21-/m1/s1 |
| InChIKey | TYVZZSICPJKKGL-OAQYLSRUSA-N |
| XLogP | 3.34 |
| TPSA | 128.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |