C17H19N3O5S — CID 25035298
[1-oxo-1-(4-sulfamoylanilino)butan-2-yl] 4-aminobenzoate (PubChem CID 25035298) has the molecular formula C17H19N3O5S and a molecular weight of 377.42 g/mol. Its IUPAC name is [1-oxo-1-(4-sulfamoylanilino)butan-2-yl] 4-aminobenzoate.
| Compound Name | [1-oxo-1-(4-sulfamoylanilino)butan-2-yl] 4-aminobenzoate |
|---|---|
| PubChem CID | 25035298 |
| Molecular Formula | C17H19N3O5S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | [1-oxo-1-(4-sulfamoylanilino)butan-2-yl] 4-aminobenzoate |
| SMILES | CCC(OC(=O)c1ccc(N)cc1)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C17H19N3O5S/c1-2-15(25-17(22)11-3-5-12(18)6-4-11)16(21)20-13-7-9-14(10-8-13)26(19,23)24/h3-10,15H,2,18H2,1H3,(H,20,21)(H2,19,23,24) |
| InChIKey | RIGGUVGCNNHEAF-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 141.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|