C33H30N4O7S — CID 25035690
[1-oxo-1-(4-sulfamoylanilino)butan-2-yl] 2,3-bis(4-methoxyphenyl)quinoxaline-6-carboxylate (PubChem CID 25035690) has the molecular formula C33H30N4O7S and a molecular weight of 626.69 g/mol. Its IUPAC name is [1-oxo-1-(4-sulfamoylanilino)butan-2-yl] 2,3-bis(4-methoxyphenyl)quinoxaline-6-carboxylate.
| Compound Name | [1-oxo-1-(4-sulfamoylanilino)butan-2-yl] 2,3-bis(4-methoxyphenyl)quinoxaline-6-carboxylate |
|---|---|
| PubChem CID | 25035690 |
| Molecular Formula | C33H30N4O7S |
| Molecular Weight | 626.69 g/mol |
| Exact Mass | 626.18 |
| IUPAC Name | [1-oxo-1-(4-sulfamoylanilino)butan-2-yl] 2,3-bis(4-methoxyphenyl)quinoxaline-6-carboxylate |
| SMILES | CCC(OC(=O)c1ccc2nc(-c3ccc(OC)cc3)c(-c3ccc(OC)cc3)nc2c1)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C33H30N4O7S/c1-4-29(32(38)35-23-10-16-26(17-11-23)45(34,40)41)44-33(39)22-9-18-27-28(19-22)37-31(21-7-14-25(43-3)15-8-21)30(36-27)20-5-12-24(42-2)13-6-20/h5-19,29H,4H2,1-3H3,(H,35,38)(H2,34,40,41) |
| InChIKey | SPPDODSMPNDBKZ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 159.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.69 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |