C17H18N2O6S — CID 1250460
[(2S)-1-oxo-1-(4-sulfamoylanilino)butan-2-yl] (E)-3-(furan-2-yl)prop-2-enoate (PubChem CID 1250460) has the molecular formula C17H18N2O6S and a molecular weight of 378.41 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(4-sulfamoylanilino)butan-2-yl] (E)-3-(furan-2-yl)prop-2-enoate.
| Compound Name | [(2S)-1-oxo-1-(4-sulfamoylanilino)butan-2-yl] (E)-3-(furan-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 1250460 |
| Molecular Formula | C17H18N2O6S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | [(2S)-1-oxo-1-(4-sulfamoylanilino)butan-2-yl] (E)-3-(furan-2-yl)prop-2-enoate |
| SMILES | CC[C@H](OC(=O)/C=C/c1ccco1)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C17H18N2O6S/c1-2-15(25-16(20)10-7-13-4-3-11-24-13)17(21)19-12-5-8-14(9-6-12)26(18,22)23/h3-11,15H,2H2,1H3,(H,19,21)(H2,18,22,23)/b10-7+/t15-/m0/s1 |
| InChIKey | GCGXINJBJCZOND-VSGCLNPGSA-N |
| XLogP | 1.90 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|