C21H31N3O3 — CID 131681097
(3aR,6aS)-1'-(5-methylfuran-2-carbonyl)-5-pentan-2-ylspiro[3a,4,6,6a-tetrahydro-2H-pyrrolo[3,4-c]pyrrole-3,4'-piperidine]-1-one (PubChem CID 131681097) has the molecular formula C21H31N3O3 and a molecular weight of 373.50 g/mol. Its IUPAC name is (3aR,6aS)-1'-(5-methylfuran-2-carbonyl)-5-pentan-2-ylspiro[3a,4,6,6a-tetrahydro-2H-pyrrolo[3,4-c]pyrrole-3,4'-piperidine]-1-one.
| Compound Name | (3aR,6aS)-1'-(5-methylfuran-2-carbonyl)-5-pentan-2-ylspiro[3a,4,6,6a-tetrahydro-2H-pyrrolo[3,4-c]pyrrole-3,4'-piperidine]-1-one |
|---|---|
| PubChem CID | 131681097 |
| Molecular Formula | C21H31N3O3 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | (3aR,6aS)-1'-(5-methylfuran-2-carbonyl)-5-pentan-2-ylspiro[3a,4,6,6a-tetrahydro-2H-pyrrolo[3,4-c]pyrrole-3,4'-piperidine]-1-one |
| SMILES | CCCC(C)N1C[C@H]2C(=O)NC3(CCN(C(=O)c4ccc(C)o4)CC3)[C@H]2C1 |
| InChI | InChI=1S/C21H31N3O3/c1-4-5-14(2)24-12-16-17(13-24)21(22-19(16)25)8-10-23(11-9-21)20(26)18-7-6-15(3)27-18/h6-7,14,16-17H,4-5,8-13H2,1-3H3,(H,22,25)/t14?,16-,17+/m1/s1 |
| InChIKey | YWPGBQVWGNSNAW-XMKPYSNPSA-N |
| XLogP | 2.43 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |