C23H32ClN3O2 — CID 131679519
(3aR,6aS)-1'-[2-(2-chlorophenyl)acetyl]-5-(2-methylbutyl)spiro[3a,4,6,6a-tetrahydro-2H-pyrrolo[3,4-c]pyrrole-3,4'-piperidine]-1-one (PubChem CID 131679519) has the molecular formula C23H32ClN3O2 and a molecular weight of 417.98 g/mol. Its IUPAC name is (3aR,6aS)-1'-[2-(2-chlorophenyl)acetyl]-5-(2-methylbutyl)spiro[3a,4,6,6a-tetrahydro-2H-pyrrolo[3,4-c]pyrrole-3,4'-piperidine]-1-one.
| Compound Name | (3aR,6aS)-1'-[2-(2-chlorophenyl)acetyl]-5-(2-methylbutyl)spiro[3a,4,6,6a-tetrahydro-2H-pyrrolo[3,4-c]pyrrole-3,4'-piperidine]-1-one |
|---|---|
| PubChem CID | 131679519 |
| Molecular Formula | C23H32ClN3O2 |
| Molecular Weight | 417.98 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | (3aR,6aS)-1'-[2-(2-chlorophenyl)acetyl]-5-(2-methylbutyl)spiro[3a,4,6,6a-tetrahydro-2H-pyrrolo[3,4-c]pyrrole-3,4'-piperidine]-1-one |
| SMILES | CCC(C)CN1C[C@H]2C(=O)NC3(CCN(C(=O)Cc4ccccc4Cl)CC3)[C@H]2C1 |
| InChI | InChI=1S/C23H32ClN3O2/c1-3-16(2)13-26-14-18-19(15-26)23(25-22(18)29)8-10-27(11-9-23)21(28)12-17-6-4-5-7-20(17)24/h4-7,16,18-19H,3,8-15H2,1-2H3,(H,25,29)/t16?,18-,19+/m1/s1 |
| InChIKey | VUQZLOHMPPDKCW-VITQDTLGSA-N |
| XLogP | 2.97 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.98 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |