C16H22N6O — CID 131681623
(3-methylcyclobutyl)-[6-(1,2,4-triazol-1-ylmethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-8-yl]methanone (PubChem CID 131681623) has the molecular formula C16H22N6O and a molecular weight of 314.39 g/mol. Its IUPAC name is (3-methylcyclobutyl)-[6-(1,2,4-triazol-1-ylmethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-8-yl]methanone.
| Compound Name | (3-methylcyclobutyl)-[6-(1,2,4-triazol-1-ylmethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-8-yl]methanone |
|---|---|
| PubChem CID | 131681623 |
| Molecular Formula | C16H22N6O |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | (3-methylcyclobutyl)-[6-(1,2,4-triazol-1-ylmethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-8-yl]methanone |
| SMILES | CC1CC(C(=O)N2Cc3nccn3CC(Cn3cncn3)C2)C1 |
| InChI | InChI=1S/C16H22N6O/c1-12-4-14(5-12)16(23)21-7-13(8-22-11-17-10-19-22)6-20-3-2-18-15(20)9-21/h2-3,10-14H,4-9H2,1H3 |
| InChIKey | SPLNYOYOZFSZDR-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 68.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |