C15H19N7S — CID 134073690
2-methyl-4-[[6-(1,2,4-triazol-1-ylmethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-8-yl]methyl]-1,3-thiazole (PubChem CID 134073690) has the molecular formula C15H19N7S and a molecular weight of 329.43 g/mol. Its IUPAC name is 2-methyl-4-[[6-(1,2,4-triazol-1-ylmethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-8-yl]methyl]-1,3-thiazole.
| Compound Name | 2-methyl-4-[[6-(1,2,4-triazol-1-ylmethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-8-yl]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 134073690 |
| Molecular Formula | C15H19N7S |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 2-methyl-4-[[6-(1,2,4-triazol-1-ylmethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-8-yl]methyl]-1,3-thiazole |
| SMILES | Cc1nc(CN2Cc3nccn3CC(Cn3cncn3)C2)cs1 |
| InChI | InChI=1S/C15H19N7S/c1-12-19-14(9-23-12)7-20-4-13(6-22-11-16-10-18-22)5-21-3-2-17-15(21)8-20/h2-3,9-11,13H,4-8H2,1H3 |
| InChIKey | QNSYAPZMBNQATC-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 64.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |