C16H25N5S — CID 97462723
N-ethyl-N-[[(6S)-8-(1,3-thiazol-2-ylmethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-6-yl]methyl]ethanamine (PubChem CID 97462723) has the molecular formula C16H25N5S and a molecular weight of 319.48 g/mol. Its IUPAC name is N-ethyl-N-[[(6S)-8-(1,3-thiazol-2-ylmethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-6-yl]methyl]ethanamine.
| Compound Name | N-ethyl-N-[[(6S)-8-(1,3-thiazol-2-ylmethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-6-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 97462723 |
| Molecular Formula | C16H25N5S |
| Molecular Weight | 319.48 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | N-ethyl-N-[[(6S)-8-(1,3-thiazol-2-ylmethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-6-yl]methyl]ethanamine |
| SMILES | CCN(CC)C[C@H]1CN(Cc2nccs2)Cc2nccn2C1 |
| InChI | InChI=1S/C16H25N5S/c1-3-19(4-2)9-14-10-20(13-16-18-6-8-22-16)12-15-17-5-7-21(15)11-14/h5-8,14H,3-4,9-13H2,1-2H3/t14-/m0/s1 |
| InChIKey | BYZKJNCLRTUWFE-AWEZNQCLSA-N |
| XLogP | 2.31 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.48 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |