C18H26N4 — CID 134069035
N,N-dimethyl-1-[8-[(4-methylphenyl)methyl]-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-6-yl]methanamine (PubChem CID 134069035) has the molecular formula C18H26N4 and a molecular weight of 298.43 g/mol. Its IUPAC name is N,N-dimethyl-1-[8-[(4-methylphenyl)methyl]-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-6-yl]methanamine.
| Compound Name | N,N-dimethyl-1-[8-[(4-methylphenyl)methyl]-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-6-yl]methanamine |
|---|---|
| PubChem CID | 134069035 |
| Molecular Formula | C18H26N4 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | N,N-dimethyl-1-[8-[(4-methylphenyl)methyl]-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-6-yl]methanamine |
| SMILES | Cc1ccc(CN2Cc3nccn3CC(CN(C)C)C2)cc1 |
| InChI | InChI=1S/C18H26N4/c1-15-4-6-16(7-5-15)11-21-12-17(10-20(2)3)13-22-9-8-19-18(22)14-21/h4-9,17H,10-14H2,1-3H3 |
| InChIKey | VPRZAVYOLTXOIN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |