C15H19F3N4O3S — CID 155829124
2-[[6-(methoxymethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-8-yl]methyl]-1,3-thiazole;2,2,2-trifluoroacetic acid (PubChem CID 155829124) has the molecular formula C15H19F3N4O3S and a molecular weight of 392.40 g/mol. Its IUPAC name is 2-[[6-(methoxymethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-8-yl]methyl]-1,3-thiazole;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[[6-(methoxymethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-8-yl]methyl]-1,3-thiazole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155829124 |
| Molecular Formula | C15H19F3N4O3S |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 2-[[6-(methoxymethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-8-yl]methyl]-1,3-thiazole;2,2,2-trifluoroacetic acid |
| SMILES | COCC1CN(Cc2nccs2)Cc2nccn2C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H18N4OS.C2HF3O2/c1-18-10-11-6-16(9-13-15-3-5-19-13)8-12-14-2-4-17(12)7-11;3-2(4,5)1(6)7/h2-5,11H,6-10H2,1H3;(H,6,7) |
| InChIKey | BAPALYKBAXAECL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |