C22H28F6N4O5S — CID 171685871
2-[[2-(cyclopentylmethyl)-7-(methoxymethyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-yl]methyl]-1,3-thiazole;bis(2,2,2-trifluoroacetic acid) (PubChem CID 171685871) has the molecular formula C22H28F6N4O5S and a molecular weight of 574.54 g/mol. Its IUPAC name is 2-[[2-(cyclopentylmethyl)-7-(methoxymethyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-yl]methyl]-1,3-thiazole;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-[[2-(cyclopentylmethyl)-7-(methoxymethyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-yl]methyl]-1,3-thiazole;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 171685871 |
| Molecular Formula | C22H28F6N4O5S |
| Molecular Weight | 574.54 g/mol |
| Exact Mass | 574.17 |
| IUPAC Name | 2-[[2-(cyclopentylmethyl)-7-(methoxymethyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-yl]methyl]-1,3-thiazole;bis(2,2,2-trifluoroacetic acid) |
| SMILES | COCC1CN(Cc2nccs2)Cc2cn(CC3CCCC3)nc21.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H26N4OS.2C2HF3O2/c1-23-13-16-10-21(12-17-19-6-7-24-17)9-15-11-22(20-18(15)16)8-14-4-2-3-5-14;2*3-2(4,5)1(6)7/h6-7,11,14,16H,2-5,8-10,12-13H2,1H3;2*(H,6,7) |
| InChIKey | LSKSYHQZOWQMCX-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.54 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |